CAS 717106-69-9

Methyl 2-(6-chloropyridin-3-yl)acetate

Description:

Methyl 2-(6-chloropyridin-3-yl)acetate is an organic compound characterized by its ester functional group, which is derived from the reaction of acetic acid and a substituted pyridine. The presence of the 6-chloropyridine moiety imparts unique properties, including potential biological activity and reactivity due to the electron-withdrawing nature of the chlorine atom. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water. The molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in synthetic organic chemistry and medicinal chemistry. Additionally, its derivatives may exhibit pharmacological properties, which could be explored in drug development. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₈ClNO₂

InChI: InChI=1S/C8H8ClNO2/c1-12-8(11)4-6-2-3-7(9)10-5-6/h2-3,5H,4H2,1H3

SMILES: COC(=O)Cc1ccc(Cl)nc1

Synonyms:

• 3-Pyridineacetic acid, 6-chloro-, methyl ester
• Methyl (6-chloro-3-pyridinyl)acetate

Methyl 2-(6-chloropyridin-3-yl)acetate

CAS: 717106-69-9

Formula: C₈H₈ClNO₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 185.6076

Ref: IN-DA00362M

Methyl 2-(6-chloropyridin-3-yl)acetate

CAS: 717106-69-9

Methyl 2-(6-chloropyridin-3-yl)acetate

Purity: 98%

Molecular weight: 185.61g/mol

Ref: 54-OR955786

Methyl 2-(6-chloropyridin-3-yl)acetate

CAS: 717106-69-9

Formula: C₈H₈ClNO₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 185.61

Ref: 10-F335382

Methyl 2-(6-chloropyridin-3-yl)acetate

CAS: 717106-69-9

Versatile small molecule scaffold

Formula: C₈H₈ClNO₂

Purity: Min. 95%

Molecular weight: 185.61 g/mol

Ref: 3D-SDB10669