CymitQuimica logo

CAS 71712-17-9

:

5-ethoxy-6-[1-(4-methoxyphenyl)ethyl]-1,3-benzodioxole

Description:
5-Ethoxy-6-[1-(4-methoxyphenyl)ethyl]-1,3-benzodioxole, with the CAS number 71712-17-9, is an organic compound characterized by its complex structure, which includes a benzodioxole core fused with an ethoxy group and a substituted ethyl group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions, including electrophilic substitutions. The presence of the methoxyphenyl group suggests that it may have interesting electronic properties, potentially influencing its reactivity and interactions with biological systems. Additionally, the ethoxy group can enhance solubility in organic solvents, making it useful in various applications, including pharmaceuticals and agrochemicals. The compound may also exhibit biological activity, although specific pharmacological properties would require further investigation. Overall, its unique structure and functional groups contribute to its potential utility in synthetic chemistry and medicinal applications.
Formula:C18H20O4
InChI:InChI=1/C18H20O4/c1-4-20-16-10-18-17(21-11-22-18)9-15(16)12(2)13-5-7-14(19-3)8-6-13/h5-10,12H,4,11H2,1-3H3
Synonyms:
  • 5-Ethoxy-6-(1-(4-methoxyphenyl)ethyl)-1,3-benzodioxole
  • 1,3-Benzodioxole, 5-ethoxy-6-(1-(4-methoxyphenyl)ethyl)-
  • 5-Ethoxy-6-[1-[4-methoxyphenyl]ethyl]-1,3-benzodioxol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.