CAS 717132-49-5
:(2S,3R,4S,5S,6S)-3,5-dibenzyloxy-2-(benzyloxymethyl)-6-[(2S,3R,4S,5S,6S)-4,5-dibenzyloxy-2-(benzyloxymethyl)-6-(4-methoxyphenoxy)tetrahydropyran-3-yl]oxy-tetrahydropyran-4-ol
Description:
The chemical substance with the name "(2S,3R,4S,5S,6S)-3,5-dibenzyloxy-2-(benzyloxymethyl)-6-[(2S,3R,4S,5S,6S)-4,5-dibenzyloxy-2-(benzyloxymethyl)-6-(4-methoxyphenoxy)tetrahydropyran-3-yl]oxy-tetrahydropyran-4-ol" and CAS number "717132-49-5" is a complex organic compound characterized by its multiple stereocenters, which contribute to its specific three-dimensional configuration. This compound features a tetrahydropyran backbone, which is a six-membered cyclic ether, and is heavily substituted with benzyloxy groups, enhancing its lipophilicity and potentially influencing its biological activity. The presence of methoxy and phenoxy groups suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its stereochemistry indicates that it may exhibit specific interactions in biological systems, which can be crucial for its function or activity. The intricate structure and functional groups suggest that it may have applications in pharmaceuticals or as a synthetic intermediate in organic synthesis. However, detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C61H64O12
InChI:InChI=1/C61H64O12/c1-63-50-32-34-51(35-33-50)70-61-59(69-41-49-30-18-7-19-31-49)58(68-40-48-28-16-6-17-29-48)56(53(72-61)43-65-37-45-22-10-3-11-23-45)73-60-57(67-39-47-26-14-5-15-27-47)54(62)55(66-38-46-24-12-4-13-25-46)52(71-60)42-64-36-44-20-8-2-9-21-44/h2-35,52-62H,36-43H2,1H3/t52-,53-,54-,55-,56+,57-,58-,59-,60-,61+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Gal[246Bn]β(1-4)Glc[236Bn]-β-MP
CAS:Formula:C61H64O12Purity:>95.0%(HPLC)Color and Shape:SolidMolecular weight:989.15374-Methoxyphenyl 4-O-(2,4,6-tri-O-benzyl-b-D-galactopyranosyl)-2,3,6-tri-O-benzyl-b-D-glucopyranoside
CAS:4-Methoxyphenyl 4-O-(2,4,6-tri-O-benzyl-b-D-galactopyranosyl)-2,3,6-tri-O-benzyl-b-D-glucopyranoside is a suppressor of genes that has been shown to be active in the treatment of leukemia. It suppresses transcription by inhibiting histone H3 acetylation and DNA replication by binding to the dna replication complex at sites of replication. The suppression of genes may be due to its ability to inhibit translation by blocking signal sequences and hybridization with complementary mRNA.Formula:C61H64O12Purity:Min. 95%Molecular weight:989.15 g/mol


