CymitQuimica logo

CAS 717133-25-0

:

4-[4-(Dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile hydrochloride

Description:
4-[4-(Dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile hydrochloride, with the CAS number 717133-25-0, is a synthetic organic compound characterized by its complex molecular structure, which includes a benzonitrile core and multiple functional groups. This compound features a dimethylamino group, which contributes to its basicity and potential for forming salts, as well as a hydroxymethyl group that may enhance its reactivity and solubility in polar solvents. The presence of a fluorophenyl moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as fluorinated compounds often exhibit improved metabolic stability and bioactivity. The hydrochloride salt form indicates that it is likely to be more soluble in water, facilitating its use in biological systems. Overall, this compound's unique structural features may confer specific pharmacological properties, making it of interest in drug discovery and development. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its potential applications.
Formula:C20H24ClFN2O2
InChI:InChI=1/C20H23FN2O2.ClH/c1-23(2)11-3-10-20(25,17-5-7-18(21)8-6-17)19-9-4-15(13-22)12-16(19)14-24;/h4-9,12,24-25H,3,10-11,14H2,1-2H3;1H
SMILES:CN(C)CCCC(c1ccc(cc1)F)(c1ccc(cc1CO)C#N)O.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.