
CAS 717138-98-2
:N-(3-Bromopropyl)-2-pyridinecarboxamide
Description:
N-(3-Bromopropyl)-2-pyridinecarboxamide is a chemical compound characterized by its unique structure, which includes a pyridine ring and a bromopropyl side chain. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The carboxamide functional group contributes to its solubility in polar solvents and can participate in hydrogen bonding, influencing its physical properties and biological activity. This compound may exhibit biological activity due to its structural features, which can interact with biological targets. Its molecular weight, melting point, and boiling point are influenced by the specific arrangement of atoms and functional groups. Additionally, the compound's stability and reactivity can be affected by environmental conditions such as temperature and pH. As with many organic compounds, safety considerations should be taken into account when handling N-(3-Bromopropyl)-2-pyridinecarboxamide, including potential toxicity and environmental impact. Overall, this compound's characteristics make it of interest in both synthetic chemistry and pharmacological research.
Formula:C9H11BrN2O
InChI:InChI=1S/C9H11BrN2O/c10-5-3-7-12-9(13)8-4-1-2-6-11-8/h1-2,4,6H,3,5,7H2,(H,12,13)
InChI key:InChIKey=ZRJIEHLZHCCHEO-UHFFFAOYSA-N
SMILES:C(NCCCBr)(=O)C1=CC=CC=N1
Synonyms:- N-(3-Bromopropyl)-2-pyridinecarboxamide
- 2-Pyridinecarboxamide, N-(3-bromopropyl)-
- Pyridine-2-carboxylic acid (3-bromopropyl)amide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.