CAS 71718-88-2
:N-Benzyl-N-(3-pyridylmethylene)amine
Description:
N-Benzyl-N-(3-pyridylmethylene)amine is an organic compound characterized by its amine functional group, which features a benzyl group and a pyridylmethylene moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. The presence of the pyridine ring contributes to its aromatic character and may influence its reactivity and solubility in various solvents. N-Benzyl-N-(3-pyridylmethylene)amine is likely to be a solid at room temperature, with potential applications in pharmaceuticals or as a ligand in coordination chemistry due to its ability to coordinate with metal ions. Its structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the compound's specific interactions with biological systems could be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C13H12N2
InChI:InChI=1/C13H12N2/c1-2-5-12(6-3-1)9-15-11-13-7-4-8-14-10-13/h1-8,10-11H,9H2
SMILES:c1ccc(cc1)CN=Cc1cccnc1
Synonyms:- N-benzyl-1-(3-pyridyl)methanimine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
