CAS 71719-06-7

3-bromo-5-pyrrolidin-2-ylpyridine

Description:

3-Bromo-5-pyrrolidin-2-ylpyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 3-position and a pyrrolidine group at the 5-position contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the presence of the nitrogen atoms in both the pyridine and pyrrolidine moieties. It is often studied for its potential biological activities, including its role as a ligand in medicinal chemistry and drug development. The bromine substituent can influence the compound's reactivity and interaction with biological targets. Additionally, the pyrrolidine group may enhance its pharmacological properties, making it of interest in various research fields, including neuroscience and pharmacology. As with many nitrogen-containing heterocycles, it may also exhibit basic properties, allowing it to participate in various chemical reactions. Safety and handling precautions should be observed due to its potential biological activity.

Formula: C₉H₁₁BrN₂

InChI: InChI=1/C9H11BrN2/c10-8-4-7(5-11-6-8)9-2-1-3-12-9/h4-6,9,12H,1-3H2

SMILES: C1CC(c2cc(cnc2)Br)NC1

Synonyms:

• 3-Bromo-5-(pyrrolidin-2-yl)pyridine
• Pyridine, 3-Bromo-5-(2-Pyrrolidinyl)-

3-Bromo-5-(2-pyrrolidinyl)pyridine

CAS: 71719-06-7

Formula: C₉H₁₁BrN₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 227.1010

Ref: IN-DA005FR9

3-Bromo-5-(pyrrolidin-2-yl)pyridine

CAS: 71719-06-7

3-Bromo-5-(pyrrolidin-2-yl)pyridine

Purity: 98%

Ref: 54-OR1041575

3-Bromo-5-(2-pyrrolidinyl)pyridine

CAS: 71719-06-7

Formula: C₉H₁₁BrN₂

Purity: 98%

Color and Shape: Liquid, No data available.

Molecular weight: 227.105

Ref: 10-F223490

(RS)-3-Bromo Nornicotine

Controlled Product

CAS: 71719-06-7

Formula: C₉H₁₁BrN₂

Color and Shape: Neat

Molecular weight: 227.101

Ref: TR-B686195