CymitQuimica logo

CAS 71720-53-1

:

6-Ethoxy-N-methyl-2-benzothiazolamine

Description:
6-Ethoxy-N-methyl-2-benzothiazolamine is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound features an ethoxy group and a methyl group attached to the nitrogen atom of the thiazole, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the ethoxy group can enhance its lipophilicity, potentially influencing its biological activity and interactions. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in drug development or as a chemical intermediate. Safety data should be consulted for handling and usage, as compounds of this nature can exhibit varying degrees of toxicity and environmental impact. Overall, 6-Ethoxy-N-methyl-2-benzothiazolamine represents a class of compounds that can be explored for their chemical reactivity and potential applications in various scientific domains.
Formula:C10H12N2OS
InChI:InChI=1S/C10H12N2OS/c1-3-13-7-4-5-8-9(6-7)14-10(11-2)12-8/h4-6H,3H2,1-2H3,(H,11,12)
InChI key:InChIKey=QWYAAGWZTKAZFC-UHFFFAOYSA-N
SMILES:O(CC)C=1C=C2C(N=C(NC)S2)=CC1
Synonyms:
  • 2-Benzothiazolamine, 6-ethoxy-N-methyl-
  • 6-Ethoxy-N-methyl-2-benzothiazolamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.