CymitQuimica logo

CAS 71726-31-3

:

9-(Ethenyloxy)-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorononane

Description:
9-(Ethenyloxy)-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorononane, with CAS number 71726-31-3, is a fluorinated organic compound characterized by a long carbon chain and multiple fluorine substituents. Its structure features a nonane backbone with a terminal ethenyloxy group, which contributes to its reactivity and potential applications in various fields, including materials science and surface chemistry. The presence of fluorine atoms imparts unique properties such as high thermal stability, low surface energy, and hydrophobicity, making it suitable for use in coatings and as a surfactant. Additionally, the ethenyloxy group allows for further chemical modifications, enhancing its versatility in polymer synthesis and functionalization. Due to its fluorinated nature, this compound may exhibit low environmental persistence and bioaccumulation potential, although specific environmental and toxicological data would be necessary for a comprehensive assessment. Overall, this compound represents a class of materials with significant industrial relevance, particularly in the development of advanced materials and coatings.
Formula:C11H6F16O
InChI:InChI=1S/C11H6F16O/c1-2-28-3-5(14,15)7(18,19)9(22,23)11(26,27)10(24,25)8(20,21)6(16,17)4(12)13/h2,4H,1,3H2
InChI key:InChIKey=PLZIKMVNRWVJKM-UHFFFAOYSA-N
SMILES:C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(C(C(C(COC=C)(F)F)(F)F)(F)F)(F)F
Synonyms:
  • 9-(Ethenyloxy)-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-Hexadecafluorononane
  • Nonane, 9-(ethenyloxy)-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-
  • 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-Hexadecafluoro-9-(vinyloxy)nonane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.