CAS 71730-08-0
:9,10-Anthracenedione, homopolymer
Description:
9,10-Anthracenedione, homopolymer, is a synthetic polymer derived from the polymerization of anthracenedione, a polycyclic aromatic compound. This substance exhibits a range of notable characteristics, including its strong chromophoric properties, which contribute to its vibrant color and potential applications in dyes and pigments. The polymer is typically insoluble in water but may dissolve in organic solvents, depending on its molecular weight and structure. It possesses good thermal stability and can withstand elevated temperatures, making it suitable for various industrial applications. Additionally, the polymer demonstrates interesting electronic properties, which can be harnessed in organic electronics and photovoltaic devices. Its structure allows for π-π stacking interactions, enhancing its conductivity and making it a candidate for use in organic semiconductors. However, handling precautions are necessary due to potential toxicity associated with its monomeric form. Overall, 9,10-Anthracenedione, homopolymer, is a versatile material with applications in fields such as materials science, electronics, and environmental remediation.
Formula:(C14H8O2)x
InChI:InChI=1S/C14H8O2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-8H
InChI key:InChIKey=RZVHIXYEVGDQDX-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=CC=CC3)=CC=CC2
Synonyms:- 9,10-Anthracenedione, homopolymer
- Polyanthraquinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
