CAS 71730-43-3
:5-tert-butyl-3-chloro-2-hydroxybenzaldehyde
Description:
5-tert-butyl-3-chloro-2-hydroxybenzaldehyde, with the CAS number 71730-43-3, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features a tert-butyl group and a chloro substituent on the benzene ring, along with a hydroxyl group, contributing to its reactivity and solubility properties. The presence of the hydroxyl group indicates that it can participate in hydrogen bonding, enhancing its solubility in polar solvents. The chloro group introduces electrophilic characteristics, making it a potential candidate for further chemical reactions, such as nucleophilic substitution. The tert-butyl group provides steric hindrance, influencing the compound's reactivity and stability. This compound may be utilized in various applications, including organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Its specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases for precise applications.
Formula:C11H13ClO2
InChI:InChI=1/C11H13ClO2/c1-11(2,3)8-4-7(6-13)10(14)9(12)5-8/h4-6,14H,1-3H3
SMILES:CC(C)(C)c1cc(C=O)c(c(c1)Cl)O
Synonyms:- Benzaldehyde, 3-chloro-5-(1,1-dimethylethyl)-2-hydroxy-
- 5-tert-Butyl-3-chloro-2-hydroxybenzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
