CAS 71730-64-8
:thr-ser-lys acetate
Description:
Thr-Ser-Lys acetate, also known by its CAS number 71730-64-8, is a synthetic peptide composed of three amino acids: threonine (Thr), serine (Ser), and lysine (Lys), with an acetate group indicating the presence of acetic acid in its structure. This compound is typically characterized by its role in biochemical research and potential applications in pharmaceuticals, particularly in the study of peptide interactions and functions. The presence of the acetate group can influence the solubility and stability of the peptide in various environments. As a peptide, it exhibits properties such as being hydrophilic due to the polar side chains of threonine and serine, while lysine contributes a positive charge at physiological pH. These characteristics make Thr-Ser-Lys acetate of interest in various fields, including drug development and molecular biology, where it may be used to explore peptide-based therapies or as a model for studying protein structure and function.
Formula:C13H26N4O6
InChI:InChI=1/C13H26N4O6/c1-7(19)10(15)12(21)17-9(6-18)11(20)16-8(13(22)23)4-2-3-5-14/h7-10,18-19H,2-6,14-15H2,1H3,(H,16,20)(H,17,21)(H,22,23)/t7-,8+,9+,10+/m1/s1
Synonyms:- Bovine Pineal Antireproductive Tripeptide
- H-Thr-Ser-Lys-OH
- L-threonyl-L-seryl-L-lysine
- Bovine Pineal Antireproductive Tripeptide Acetate Salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Bovine Pineal Antireproductive Tripeptide acetate salt
CAS:Bovine pineal antiprogestin tripeptide acetate salt H-Thr-Ser-Lys-OH acetate salt is a molecule that binds to the prolactin receptor. It is a hydroxyl group reactive, carboxy terminal β amino acid analog of prolactin. It has been shown to have inhibitory properties in cancer cells and can be used as a diagnostic agent for tumor growth. This molecule also inhibits the activity of the prolactin receptor with micrometer-sized particles and has diagnostic potential in breast cancer cells.Formula:C13H26N4O6Purity:Min. 95%Molecular weight:334.37 g/mol
