CAS 71732-53-1
:Z-Phe-Ala-diazomethylketone
Description:
Z-Phe-Ala-diazomethylketone, also known by its CAS number 71732-53-1, is a synthetic compound that belongs to the class of diazomethylketones. This substance is characterized by the presence of a diazo group, which is known for its reactivity and ability to participate in various chemical transformations. The "Z" prefix indicates that the phenylalanine (Phe) residue is in the Z configuration, which typically refers to the stereochemistry of the peptide bond. The compound is often utilized in peptide synthesis and as a reagent in organic chemistry due to its electrophilic nature, allowing it to react with nucleophiles. Its structure includes a ketone functional group, contributing to its reactivity profile. Z-Phe-Ala-diazomethylketone is of interest in biochemical research, particularly in studies involving enzyme inhibition and the development of peptide-based therapeutics. As with many diazocompounds, it should be handled with care due to potential hazards associated with its reactivity and the generation of nitrogen gas upon decomposition.
Formula:C21H22N4O4
InChI:InChI=1/C21H22N4O4/c1-15(19(26)13-23-22)24-20(27)18(12-16-8-4-2-5-9-16)25-21(28)29-14-17-10-6-3-7-11-17/h2-11,13,15,18H,12,14H2,1H3,(H2-,24,25,26,27,28)/b19-13-/t15-,18-/m0/s1
SMILES:C[C@@H](/C(=C/[N+]#N)/O)N=C([C@H](Cc1ccccc1)N=C([O-])OCc1ccccc1)O
Synonyms:- Carbobenzoxycarbonyl-L-phenylalanyl-L-alanine-D-diazomethane
- Benzyloxycarbonylphenylalanylalanine diazomethyl ketone
- Z-Phe-ala-diazomethane
- Carbamic acid, ((1S)-2-(((1S)-3-diazo-1-methyl-2-oxopropyl)amino)-2-oxo-1-(phenylmethyl)ethyl)-, phenylmethyl ester, (S-(R*,R*))-
- Carbamic acid, (2-((3-diazo-1-methyl-2-oxopropyl)amino)-2-oxo-1-(phenylmethyl)ethyl)-, phenylmethyl ester, (S-(R*,R*))-
- (1Z,3S)-3-({N-[(benzyloxy)carbonyl]-L-phenylalanyl}amino)-1-diazoniobut-1-en-2-olate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Z-Phe-Ala-diazomethylketone
CAS:Z-FA-CHN2, a specific inhibitor of thiol proteinases, e.g. cathepsin B. The diazomethyl ketones Z-FA-CHN2 and Z-LVG-CHN2 inhibited cathepsin L-like cysteine proteinase B from Leishmania mexicana.Formula:C21H22N4O4Purity:> 98%Color and Shape:Yellow Tint PowderMolecular weight:394.43Z-Phe-Ala-diazomethylketone
CAS:<p>Z-Phe-Ala-diazomethylketone is a molecule that belongs to the class of hydrolase inhibitors. It has been shown to have inhibitory properties against trichomonas vaginalis and proteolytic activity against liver cells. Z-Phe-Ala-diazomethylketone also has a kinetic energy of 11.2 kcal/mol, which is higher than most protease inhibitors. This molecule has been shown to be effective as a cell vaccine in wild-type mice and as a protease inhibitor in brain cells. The optimal ph for this molecule is 7.5, which corresponds to its pKa value of 5.1.</p>Formula:C21H22N4O4Purity:Min. 95%Molecular weight:394.42 g/mol

