CAS 71739-65-6

4-oxo-4-(1H-pyrrol-2-yl)butanoic acid

Description:

4-Oxo-4-(1H-pyrrol-2-yl)butanoic acid, identified by its CAS number 71739-65-6, is an organic compound characterized by its unique structure that includes a pyrrole ring and a carboxylic acid functional group. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group, which can donate protons in solution. The pyrrole moiety contributes to its potential biological activity, as pyrrole derivatives are often found in various natural products and pharmaceuticals. The compound may display moderate solubility in polar solvents, influenced by the carboxylic acid group, while its stability can be affected by environmental conditions such as pH and temperature. Additionally, the presence of the carbonyl group (oxo) suggests potential reactivity in condensation reactions or as a site for nucleophilic attack. Overall, 4-oxo-4-(1H-pyrrol-2-yl)butanoic acid is of interest in synthetic organic chemistry and may have applications in medicinal chemistry due to its structural features.

Formula: C₈H₉NO₃

InChI: InChI=1/C8H9NO3/c10-7(3-4-8(11)12)6-2-1-5-9-6/h1-2,5,9H,3-4H2,(H,11,12)

SMILES: c1cc(C(=O)CCC(=O)O)[nH]c1

4-Oxo-4-(1H-pyrrol-2-yl)butanoic acid

CAS: 71739-65-6

Versatile small molecule scaffold

Formula: C₈H₉NO₃

Purity: Min. 95%

Molecular weight: 167.16 g/mol

Ref: 3D-WCA73965