CAS 7175-49-7
:N-Cyclohexyl-N-ethylcyclohexanamine
Description:
N-Cyclohexyl-N-ethylcyclohexanamine, with the CAS number 7175-49-7, is an organic compound that belongs to the class of amines. It features a cyclohexyl group and an ethyl group attached to a central nitrogen atom, which contributes to its unique properties. This compound is typically characterized by its relatively low volatility and moderate solubility in organic solvents, making it useful in various chemical applications. It may exhibit basicity due to the presence of the amine functional group, allowing it to participate in acid-base reactions. Additionally, N-Cyclohexyl-N-ethylcyclohexanamine may have applications in the synthesis of other chemical compounds or as an intermediate in organic synthesis. Safety data indicates that, like many amines, it should be handled with care due to potential irritant properties. Overall, its structural features and chemical behavior make it a compound of interest in both industrial and research settings.
Formula:C14H27N
InChI:InChI=1S/C14H27N/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h13-14H,2-12H2,1H3
InChI key:InChIKey=XRKQMIFKHDXFNQ-UHFFFAOYSA-N
SMILES:N(CC)(C1CCCCC1)C2CCCCC2
Synonyms:- Cyclohexanamine, N-cyclohexyl-N-ethyl-
- Dicyclohexylamine, N-ethyl-
- Dicyclohexylethylamine
- Ethyldicyclohexylamine
- N-Ethyldicyclohexylamine
- N-cyclohexyl-N-ethylcyclohexanamine
- N-cyclohexyl-N-ethylcyclohexanaminium
- NSC 221147
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
