CymitQuimica logo

CAS 7176-19-4

:

1,3,5-Tris(2-oxiranylmethyl) 1,3,5-benzenetricarboxylate

Description:
1,3,5-Tris(2-oxiranylmethyl) 1,3,5-benzenetricarboxylate, with CAS number 7176-19-4, is an organic compound characterized by its structure, which includes a benzene ring substituted with three carboxylate groups and three epoxide groups. This compound is typically used in polymer chemistry and as a crosslinking agent due to its ability to undergo ring-opening reactions, which can enhance the mechanical properties of materials. It is generally a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. The presence of multiple reactive epoxide groups allows for various applications in coatings, adhesives, and sealants, where it can contribute to improved durability and resistance to environmental factors. Additionally, the compound may exhibit low volatility and moderate solubility in organic solvents, making it suitable for various industrial applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C18H18O9
InChI:InChI=1S/C18H18O9/c19-16(25-7-13-4-22-13)10-1-11(17(20)26-8-14-5-23-14)3-12(2-10)18(21)27-9-15-6-24-15/h1-3,13-15H,4-9H2
InChI key:InChIKey=UNTJEZNVLMAXQI-UHFFFAOYSA-N
SMILES:C(OCC1CO1)(=O)C2=CC(C(OCC3CO3)=O)=CC(C(OCC4CO4)=O)=C2
Synonyms:
  • 1-Propanol, 2,3-epoxy-, 1,3,5-benzenetricarboxylate (3:1)
  • 1,3,5-Benzenetricarboxylic acid, 1,3,5-tris(2-oxiranylmethyl) ester
  • 1,3,5-Benzenetricarboxylic acid, tris(oxiranylmethyl) ester
  • 1,3,5-Benzenetricarboxylic acid, tris(2,3-epoxypropyl) ester
  • 1,3,5-Tris(2-oxiranylmethyl) 1,3,5-benzenetricarboxylate
Found 1 products.