CAS 71760-44-6

4-[3-(morpholin-4-yl)propoxy]benzaldehyde

Description:

4-[3-(Morpholin-4-yl)propoxy]benzaldehyde, with the CAS number 71760-44-6, is an organic compound characterized by its aromatic aldehyde structure. It features a benzaldehyde moiety, which is a benzene ring with a formyl group (-CHO) attached, and a propoxy group that is substituted with a morpholine ring. The presence of the morpholine group, a six-membered heterocyclic compound containing both oxygen and nitrogen, contributes to the compound's potential biological activity and solubility properties. This compound is typically a white to off-white solid and is soluble in organic solvents. Its functional groups suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the ability of morpholine derivatives to interact with biological targets. Additionally, the compound may exhibit various chemical reactivity patterns, including electrophilic substitution and nucleophilic addition, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₁₄H₁₉NO₃

InChI: InChI=1/C14H19NO3/c16-12-13-2-4-14(5-3-13)18-9-1-6-15-7-10-17-11-8-15/h2-5,12H,1,6-11H2

SMILES: C(CN1CCOCC1)COc1ccc(cc1)C=O