CAS 7177-97-1

3-[(5Z)-5-(4-chlorobenzylidene)-4-oxo-2-thioxo-1,3-thiazolidin-3-yl]propanoate

Description:

3-[(5Z)-5-(4-chlorobenzylidene)-4-oxo-2-thioxo-1,3-thiazolidin-3-yl]propanoate, with the CAS number 7177-97-1, is a thiazolidinone derivative characterized by its unique structural features, including a thiazolidine ring and a propanoate moiety. This compound typically exhibits a yellow to orange color and is soluble in organic solvents, which is common for many thiazolidinone derivatives. The presence of the 4-chlorobenzylidene group suggests potential biological activity, as modifications on the benzylidene can influence the compound's interaction with biological targets. Thiazolidinones are known for their diverse pharmacological properties, including anti-inflammatory and antimicrobial activities, making this compound of interest in medicinal chemistry. Its thioxo group contributes to its reactivity and potential applications in organic synthesis. Overall, the compound's characteristics, including its molecular structure and functional groups, suggest it may have significant implications in pharmaceutical research and development.

Formula: C₁₃H₉ClNO₃S₂

InChI: InChI=1/C13H10ClNO3S2/c14-9-3-1-8(2-4-9)7-10-12(18)15(13(19)20-10)6-5-11(16)17/h1-4,7H,5-6H2,(H,16,17)/p-1/b10-7-

SMILES: c1cc(ccc1/C=C\1/C(=O)N(CCC(=O)[O-])C(=S)S1)Cl