CAS 71771-90-9
:Denopamine
Description:
Denopamine is a synthetic compound classified as a selective beta-1 adrenergic agonist, primarily used in the context of cardiovascular research and potential therapeutic applications. It is known for its ability to enhance cardiac contractility and improve heart function without significantly increasing heart rate, making it of interest in treating heart failure and other cardiac conditions. Denopamine exhibits a relatively short half-life, which can influence its pharmacokinetics and dosing regimen. The compound is typically administered in a controlled setting, as its effects on the cardiovascular system can vary based on dosage and individual patient factors. In terms of chemical structure, denopamine features a phenethylamine backbone, which is common among adrenergic agents, and it possesses specific functional groups that contribute to its selectivity for beta-1 receptors. As with many pharmacological agents, understanding its mechanism of action, potential side effects, and interactions with other medications is crucial for its safe and effective use in clinical settings.
Formula:C18H23NO4
InChI:InChI=1S/C18H23NO4/c1-22-17-8-3-13(11-18(17)23-2)9-10-19-12-16(21)14-4-6-15(20)7-5-14/h3-8,11,16,19-21H,9-10,12H2,1-2H3/t16-/m0/s1
InChI key:InChIKey=VHSBBVZJABQOSG-INIZCTEOSA-N
SMILES:C(CNC[C@H](O)C1=CC=C(O)C=C1)C2=CC(OC)=C(OC)C=C2
Synonyms:- (R)-(-)-Denopamine
- (αR)-α-[[[2-(3,4-Dimethoxyphenyl)ethyl]amino]methyl]-4-hydroxybenzenemethanol
- 4-(2-{[2-(3,4-Dimethoxyphenyl)Ethyl]Amino}-1-Hydroxyethyl)Phenol
- 4-[(1R)-2-{[2-(3,4-dimethoxyphenyl)ethyl]amino}-1-hydroxyethyl]phenol
- 4-[(1S)-2-{[2-(3,4-dimethoxyphenyl)ethyl]amino}-1-hydroxyethyl]phenol
- Benzenemethanol, Alpha-[[[2-(3,4-Dimethoxyphenyl)Ethyl]Amino]Methyl]-4-Hydroxy-
- Benzenemethanol, α-[[[2-(3,4-dimethoxyphenyl)ethyl]amino]methyl]-4-hydroxy-, (R)-
- Benzenemethanol, α-[[[2-(3,4-dimethoxyphenyl)ethyl]amino]methyl]-4-hydroxy-, (αR)-
- Carguto
- Kalgut
- Ta 064
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
(R)-(-)-Denopamine
CAS:Controlled ProductFormula:C18H23NO4Color and Shape:NeatMolecular weight:317.38Denopamine
CAS:Denopamine is an agonist of 1-Adrenoceptor.Formula:C18H23NO4Color and Shape:SolidMolecular weight:317.38


