CAS 71776-72-2

O-Methyl-L-threonine methyl ester

Description:

O-Methyl-L-threonine methyl ester, with the CAS number 71776-72-2, is a chemical compound that belongs to the class of amino acid derivatives. It is characterized by the presence of a threonine backbone, which is an essential amino acid, modified by the addition of methyl groups. This modification can influence its solubility, reactivity, and biological activity. The compound typically appears as a white to off-white solid and is soluble in polar solvents such as methanol and water, owing to its polar functional groups. O-Methyl-L-threonine methyl ester is often utilized in biochemical research and synthesis, particularly in studies related to protein synthesis and metabolic pathways. Its methyl ester form can enhance its stability and bioavailability compared to the free amino acid. Additionally, it may exhibit specific interactions with enzymes or receptors due to its structural characteristics, making it a subject of interest in medicinal chemistry and pharmacology. As with many chemical substances, proper handling and safety precautions are essential when working with this compound.

Formula: C₆H₁₃NO₃

InChI: InChI=1S/C6H13NO3/c1-4(9-2)5(7)6(8)10-3/h4-5H,7H2,1-3H3/t4-,5+/m1/s1

InChI key: InChIKey=ZGSFKAVIRXLMRI-UHNVWZDZSA-N

SMILES: [C@H]([C@H](OC)C)(C(OC)=O)N

Synonyms:

• Butyric acid, 2-amino-3-methoxy-, methyl ester
• O-Methyl-L-threonine methyl ester
• L-Threonine, O-methyl-, methyl ester