CAS 71783-41-0
:3-(2,4-Dinitrophenylamino)propyltriethoxysilane
Description:
3-(2,4-Dinitrophenylamino)propyltriethoxysilane, with CAS number 71783-41-0, is an organosilane compound characterized by its unique structure that combines a silane group with a dinitrophenylamino moiety. This compound typically exhibits properties such as good adhesion to various substrates, making it useful in applications like surface modification and as a coupling agent in composite materials. The presence of the dinitrophenyl group imparts potential for reactivity, particularly in applications involving functionalization or as a precursor in the synthesis of more complex materials. Additionally, the triethoxysilane part of the molecule allows for hydrolysis and subsequent condensation reactions, facilitating the formation of siloxane networks upon exposure to moisture. This compound may also exhibit biological activity due to the dinitrophenyl group, which can influence its behavior in biological systems. Safety considerations should be taken into account, as dinitrophenyl compounds can be hazardous. Overall, this substance is valuable in both industrial and research settings for its multifunctional properties.
Formula:C15H25N3O7Si
InChI:InChI=1/C15H25N3O7Si/c1-4-23-26(24-5-2,25-6-3)11-7-10-16-14-9-8-13(17(19)20)12-15(14)18(21)22/h8-9,12,16H,4-7,10-11H2,1-3H3
SMILES:CCO[Si](CCCNc1ccc(cc1N(=O)=O)N(=O)=O)(OCC)OCC
Synonyms:- Dinitrophenylaminopropyltriethoxysilane
- 2,4-dinitro-N-[3-(triethoxysilyl)propyl]aniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(2,4-Dinitrophenylamino)propyltriethoxysilane
CAS:<p>S07660 - 3-(2,4-Dinitrophenylamino)propyltriethoxysilaneN-[3-triethoxysilylpropyl]-2,4 dinitrophenylamine</p>Formula:C15H25N3O7SiColor and Shape:SolidMolecular weight:387.464
