CAS 717843-48-6

3-bromo-6-methylpyridine-2-carbonitrile

Description:

3-Bromo-6-methylpyridine-2-carbonitrile is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 3-position and a methyl group at the 6-position contributes to its unique chemical properties. The carbonitrile functional group (-C≡N) at the 2-position enhances its reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, the presence of halogen and nitrile groups can influence its electronic properties, reactivity, and stability. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-bromo-6-methylpyridine-2-carbonitrile is a versatile compound with significant implications in chemical research and industry.

Formula: C₇H₅BrN₂

InChI: InChI=1/C7H5BrN2/c1-5-2-3-6(8)7(4-9)10-5/h2-3H,1H3

SMILES: Cc1ccc(c(C#N)n1)Br

Synonyms:

• 2-Pyridinecarbonitrile, 3-Bromo-6-Methyl-
• 3-Bromo-6-Methylpicolinonitrile

3-Bromo-2-cyano-6-methylpyridine

CAS: 717843-48-6

Formula: C₇H₅BrN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 197.0320

Ref: IN-DA00FFX9

3-Bromo-6-methylpyridine-2-carbonitrile

CAS: 717843-48-6

3-Bromo-6-methylpyridine-2-carbonitrile

Purity: 98%

Molecular weight: 197.03g/mol

Ref: 54-OR5836

3-Bromo-2-cyano-6-methylpyridine

CAS: 717843-48-6

Formula: C₇H₅BrN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 197.035

Ref: 10-F215639

3-Bromo-6-methylpyridine-2-carbonitrile

CAS: 717843-48-6

3-Bromo-6-methylpyridine-2-carbonitrile is a chiral compound. It has been used as a raw material to produce various organic compounds, such as enantiomers and optical isomers. 3-Bromo-6-methylpyridine-2-carbonitrile can be prepared by cross coupling reaction with an optically active boronic acid or ester in the presence of a base. The optical purity of the molecule can be determined using either preparative high performance liquid chromatography (prep HPLC) or dichroism spectroscopy.

Formula: C₇H₅BrN₂

Purity: Min. 95%

Molecular weight: 197.04 g/mol

Ref: 3D-SDB84348