CymitQuimica logo

CAS 717847-03-5

:

6-(Morpholin-4-yl)pyrazin-2-amine

Description:
6-(Morpholin-4-yl)pyrazin-2-amine is a chemical compound characterized by its pyrazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a morpholine group, a six-membered ring containing both oxygen and nitrogen, contributes to its unique properties, including potential solubility in polar solvents. This compound typically exhibits basic characteristics due to the amine functional group, which can participate in hydrogen bonding and may influence its reactivity and interaction with biological targets. It is often studied in medicinal chemistry for its potential pharmacological applications, particularly in the development of new therapeutic agents. The molecular structure allows for various substitutions, which can affect its biological activity and pharmacokinetics. Additionally, the compound's stability, melting point, and solubility can vary based on environmental conditions and the presence of other chemical entities. Overall, 6-(Morpholin-4-yl)pyrazin-2-amine represents a class of compounds with significant interest in drug discovery and development.
Formula:C8H12N4O
InChI:InChI=1/C8H12N4O/c9-7-5-10-6-8(11-7)12-1-3-13-4-2-12/h5-6H,1-4H2,(H2,9,11)
InChI key:PTQRJZXZMRXHBW-UHFFFAOYSA-N
SMILES:C1COCCN1c1cncc(N)n1
Synonyms:
  • 2-Pyrazinamine, 6-(4-Morpholinyl)-
Found 4 products.