CAS 71789-10-1
:Trimethyl(penta-1,4-diyn-1-yl)silane
Description:
Trimethyl(penta-1,4-diyn-1-yl)silane is an organosilicon compound characterized by the presence of a silicon atom bonded to three methyl groups and a penta-1,4-diyn-1-yl group, which features a linear chain of five carbon atoms with two conjugated triple bonds. This structure imparts unique properties, including potential reactivity due to the presence of the acetylenic groups, which can participate in various chemical reactions such as cycloadditions or polymerizations. The compound is typically colorless to pale yellow and may exhibit a low to moderate volatility, depending on its molecular weight and structure. Its silane component suggests that it may have applications in materials science, particularly in the synthesis of silicone-based polymers or as a coupling agent in organic synthesis. Additionally, the presence of multiple triple bonds can enhance its utility in organic synthesis, particularly in the formation of complex molecules. Safety data should be consulted, as compounds with similar structures may pose hazards such as flammability or toxicity.
Formula:C8H12Si
InChI:InChI=1/C8H12Si/c1-5-6-7-8-9(2,3)4/h1H,6H2,2-4H3
SMILES:C#CCC#C[Si](C)(C)C
Synonyms:- Silane, trimethyl-1,4-pentadiyn-1-yl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Trimethylsilyl-1,4-pentadiyne, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C8H12SiPurity:98%Molecular weight:136.271-Trimethylsilyl-1,4-pentadiyne
CAS:<p>S19940 - 1-Trimethylsilyl-1,4-pentadiyne</p>Formula:C8H12SiPurity:95%Color and Shape:Clear dark orange liquidMolecular weight:136.2691-Trimethylsilyl-1,4-pentadiyne
CAS:<p>1-Trimethylsilyl-1,4-pentadiyne is a chemical compound. It has a phenyl ring and a lipase ligand. This chemical has been shown to be able to transfer hydrocarbons from one side of the molecule to the other, with an efficiency of around 80%. The ligands on 1-trimethylsilyl-1,4-pentadiyne are hydride ligands that can undergo asymmetric hydrogenation reactions. This chemical also has a diffraction pattern that is characteristic of tetranuclear complexes. 1-Trimethylsilyl-1,4-pentadiyne is activated by electron bombardment and can undergo regioselective reactions with carbonyls and epoxides.</p>Formula:C8H12SiPurity:Min. 95%Molecular weight:136.27 g/mol


