CymitQuimica logo

CAS 717904-36-4

:

(4-methylpiperazin-1-yl)(oxo)acetic acid

Description:
(4-Methylpiperazin-1-yl)(oxo)acetic acid is a chemical compound characterized by its piperazine ring structure, which is a six-membered ring containing two nitrogen atoms. The presence of the 4-methyl group indicates a methyl substituent on the fourth carbon of the piperazine ring, contributing to its steric and electronic properties. The oxo group (C=O) attached to the acetic acid moiety suggests that this compound has both basic and acidic functionalities, making it potentially useful in various chemical reactions and applications. Its molecular structure allows for hydrogen bonding, which can influence its solubility and reactivity in different solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Additionally, its CAS number, 717904-36-4, provides a unique identifier for regulatory and safety information. Overall, (4-methylpiperazin-1-yl)(oxo)acetic acid is a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C7H12N2O3
InChI:InChI=1/C7H12N2O3/c1-8-2-4-9(5-3-8)6(10)7(11)12/h2-5H2,1H3,(H,11,12)
SMILES:CN1CCN(CC1)C(=O)C(=O)O
Synonyms:
  • 1-Piperazineacetic acid, 4-methyl-alpha-oxo-
  • (4-Methylpiperazin-1-yl)(oxo)acetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.