CymitQuimica logo

CAS 71797-47-2

:

N-phenethylpentan-3-amine

Description:
N-phenethylpentan-3-amine, identified by its CAS number 71797-47-2, is an organic compound characterized by its amine functional group and a phenethyl substituent. This compound features a pentane backbone with an amine group located at the third carbon, which contributes to its basicity and potential reactivity. The presence of the phenethyl group enhances its lipophilicity, allowing for better interaction with biological membranes. N-phenethylpentan-3-amine may exhibit stimulant properties, similar to other amines, and could be of interest in pharmacological research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds targeting the central nervous system. However, detailed studies on its pharmacokinetics, toxicity, and specific biological effects are essential for a comprehensive understanding of its characteristics and potential uses. As with many amines, it may also participate in various chemical reactions, including alkylation and acylation, making it a versatile compound in synthetic organic chemistry.
Formula:C13H21N
InChI:InChI=1/C13H21N/c1-3-13(4-2)14-11-10-12-8-6-5-7-9-12/h5-9,13-14H,3-4,10-11H2,1-2H3
SMILES:CCC(CC)NCCc1ccccc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.