CAS 718-43-4
:N-(3-chlorophenyl)-1,3,5-triazine-2,4-diamine
Description:
N-(3-chlorophenyl)-1,3,5-triazine-2,4-diamine, with the CAS number 718-43-4, is an organic compound characterized by its triazine ring structure, which is a six-membered aromatic heterocycle containing three nitrogen atoms. This compound features a chlorophenyl group attached to the triazine, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of amino groups on the triazine ring enhances its reactivity, making it useful in various applications, including as an intermediate in the synthesis of dyes, agrochemicals, and pharmaceuticals. The chlorophenyl substituent can influence the compound's electronic properties and biological activity. Additionally, this compound may exhibit specific interactions with biological targets, which can be of interest in medicinal chemistry. Safety data should be consulted for handling and potential hazards, as with any chemical substance. Overall, N-(3-chlorophenyl)-1,3,5-triazine-2,4-diamine is a versatile compound with significant implications in chemical research and industry.
Formula:C9H8ClN5
InChI:InChI=1/C9H8ClN5/c10-6-2-1-3-7(4-6)14-9-13-5-12-8(11)15-9/h1-5H,(H3,11,12,13,14,15)
SMILES:c1cc(cc(c1)Nc1ncnc(=N)[nH]1)Cl
Synonyms:- 1,3,5-triazine-2,4-diamine, N~2~-(3-chlorophenyl)-
- N2-(3-chlorophenyl)-1,3,5-triazine-2,4-diamine
- N-(3-Chlorophenyl)-1,3,5-triazine-2,4-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
