CymitQuimica logo

CAS 71812-08-3

:

(2S,5S,11R,11aR,14aR,14bS)-16-methyldodecahydro-4H-5,2-(epiminomethano)-11,7-(metheno)azacycloundecino[3,2,1-hi]indole-10,12-dione

Description:
The chemical substance with the name "(2S,5S,11R,11aR,14aR,14bS)-16-methyldodecahydro-4H-5,2-(epiminomethano)-11,7-(metheno)azacycloundecino[3,2,1-hi]indole-10,12-dione" and CAS number "71812-08-3" is a complex organic compound characterized by its intricate polycyclic structure, which includes multiple stereocenters contributing to its chiral nature. This compound features a bicyclic framework that incorporates nitrogen within its ring system, indicative of its classification as an azacyclic compound. The presence of various functional groups, such as diones and imines, suggests potential reactivity and biological activity, making it of interest in medicinal chemistry. Its stereochemistry is crucial for understanding its interactions with biological targets, as the spatial arrangement of atoms can significantly influence its pharmacological properties. Additionally, the compound's molecular weight and solubility characteristics would be relevant for its application in drug formulation and development. Overall, this substance exemplifies the complexity and diversity found in organic chemistry, particularly in the realm of natural product synthesis and pharmaceutical research.
Formula:C19H26N2O2
InChI:InChI=1/C19H26N2O2/c1-20-9-14-8-12-3-5-17(23)18-15-7-11(2-4-16(15)22)6-13(20)10-21(14)19(12)18/h7,12-15,18-19H,2-6,8-10H2,1H3/t12-,13+,14+,15+,18+,19+/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.