
CAS 71815-44-6
:3-Iodo-2-propenoic acid
Description:
3-Iodo-2-propenoic acid, also known as 3-iodoprop-2-enoic acid, is an organic compound characterized by the presence of both an iodine atom and a carboxylic acid functional group. It features a propenoic acid backbone, which is an unsaturated compound with a double bond between the second and third carbon atoms. The iodine substitution at the third carbon enhances its reactivity, making it useful in various chemical syntheses, particularly in the field of organic chemistry. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. 3-Iodo-2-propenoic acid can participate in various chemical reactions, including nucleophilic substitutions and additions, making it valuable in the synthesis of more complex molecules. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of iodine and its reactive nature.
Formula:C3H3IO2
InChI:InChI=1S/C3H3IO2/c4-2-1-3(5)6/h1-2H,(H,5,6)
InChI key:InChIKey=IBFDLVHJHUMSAC-UHFFFAOYSA-N
SMILES:C(C(O)=O)=CI
Synonyms:- 3-Iodo-2-propenoic acid
- Acrylic acid, 3-iodo-
- 2-Propenoic acid, 3-iodo-
- 3-Iodo-2-propen-1-oic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.