
CAS 71816-39-2
:Boron nitrate (B(NO3)3)
Description:
Boron nitrate, with the chemical formula B(NO3)3 and CAS number 71816-39-2, is an inorganic compound characterized by its white crystalline appearance. It is a boron-containing compound where boron is coordinated with three nitrate groups. This substance is known for its solubility in water and polar solvents, which facilitates its use in various chemical applications. Boron nitrate exhibits properties typical of both boron and nitrate ions, including potential reactivity with bases and acids. It is often utilized in the synthesis of boron-containing materials and as a precursor in the production of boron nitride, a material with excellent thermal and chemical stability. Additionally, boron nitrate can serve as a catalyst in organic reactions and has potential applications in the field of materials science, particularly in the development of advanced ceramics and composites. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:BN3O9
InChI:InChI=1S/BN3O9/c5-2(6)11-1(12-3(7)8)13-4(9)10
InChI key:InChIKey=BPOQYTGGYMESKB-UHFFFAOYSA-N
SMILES:B(ON(=O)=O)(ON(=O)=O)ON(=O)=O
Synonyms:- Boric acid, trinitro ester
- Boron nitrate (B(NO3)3)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
