CAS 7182-08-3
:1-morpholino-1-cycloheptene
Description:
1-Morpholino-1-cycloheptene is an organic compound characterized by its unique structure, which features a morpholine ring and a cycloheptene moiety. The morpholine group contributes to its heterocyclic nature, providing properties such as increased solubility in polar solvents and potential for hydrogen bonding. This compound typically exhibits a colorless to pale yellow appearance and has a distinctive odor. It is known for its reactivity, particularly in organic synthesis, where it can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. The presence of the double bond in the cycloheptene structure makes it susceptible to electrophilic addition reactions. Additionally, 1-morpholino-1-cycloheptene may have applications in medicinal chemistry and material science due to its structural features. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Proper safety protocols should be followed when working with this substance in a laboratory setting.
Formula:C11H19NO
InChI:InChI=1/C11H19NO/c1-2-4-6-11(5-3-1)12-7-9-13-10-8-12/h5H,1-4,6-10H2
SMILES:C1CCCC(=CC1)N1CCOCC1
Synonyms:- 4-(Cyclohept-1-En-1-Yl)Morpholine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
