CAS 7182-43-6

4-Hydroxy-γ-oxobenzenebutanenitrile

Description:

4-Hydroxy-γ-oxobenzenebutanenitrile, with the CAS number 7182-43-6, is an organic compound characterized by its functional groups, including a hydroxyl group (-OH), a nitrile group (-C≡N), and a ketone group (part of the γ-oxobenzene structure). This compound typically appears as a solid or crystalline substance and is soluble in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, particularly in the development of biologically active compounds. The presence of the nitrile group may also impart unique reactivity, making it useful in various chemical reactions, such as nucleophilic additions. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.

Formula: C₁₀H₉NO₂

InChI: InChI=1S/C10H9NO2/c11-7-1-2-10(13)8-3-5-9(12)6-4-8/h3-6,12H,1-2H2

InChI key: InChIKey=UWKILYOZMUXVHI-UHFFFAOYSA-N

SMILES: C(CCC#N)(=O)C1=CC=C(O)C=C1

Synonyms:

• 4-Hydroxy-β-cyanopropiophenone
• Benzenebutanenitrile, 4-hydroxy-γ-oxo-
• 4-Hydroxy-γ-oxobenzenebutanenitrile
• Propionitrile, 3-(p-hydroxybenzoyl)-