
CAS 71820-57-0
:1-(Cyclopropylmethyl)-2-pyrrolidinemethanamine
Description:
1-(Cyclopropylmethyl)-2-pyrrolidinemethanamine, with the CAS number 71820-57-0, is a chemical compound that belongs to the class of amines. It features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and a cyclopropylmethyl group, contributing to its unique structural characteristics. This compound is typically characterized by its potential biological activity, which may include interactions with neurotransmitter systems, making it of interest in pharmacological research. Its molecular structure suggests it may exhibit properties such as lipophilicity, which can influence its solubility and permeability in biological systems. Additionally, the presence of both aliphatic and cyclic components in its structure may affect its reactivity and stability. As with many amines, it may also participate in hydrogen bonding, influencing its interactions with other molecules. Overall, 1-(Cyclopropylmethyl)-2-pyrrolidinemethanamine is a compound of interest in medicinal chemistry and drug development, warranting further investigation into its properties and potential applications.
Formula:C9H18N2
InChI:InChI=1S/C9H18N2/c10-6-9-2-1-5-11(9)7-8-3-4-8/h8-9H,1-7,10H2
InChI key:InChIKey=QFIYFROFRTUSPW-UHFFFAOYSA-N
SMILES:C(N1C(CN)CCC1)C2CC2
Synonyms:- [1-(Cyclopropylmethyl)pyrrolidin-2-yl]methanamine
- 1-[1-(Cyclopropylmethyl)pyrrolidin-2-yl]methanamine
- 1-(Cyclopropylmethyl)-2-pyrrolidinemethanamine
- 2-Pyrrolidinemethanamine, 1-(cyclopropylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.