CAS 71821-98-2

2,2-dimethyl-4-oxo-4-(p-tolyl)butanoic acid

Description:

2,2-Dimethyl-4-oxo-4-(p-tolyl)butanoic acid, with the CAS number 71821-98-2, is an organic compound characterized by its complex structure, which includes a ketone and a carboxylic acid functional group. This compound features a butanoic acid backbone with two methyl groups at the second carbon and a p-tolyl group (a para-substituted phenyl group) at the fourth carbon. The presence of the ketone group contributes to its reactivity and potential applications in organic synthesis. Typically, compounds of this nature exhibit moderate solubility in organic solvents and may have limited solubility in water due to their hydrophobic aromatic components. The compound may be utilized in various chemical reactions, including as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the conditions under which it is studied. Safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₃H₁₆O₃

InChI: InChI=1/C13H16O3/c1-9-4-6-10(7-5-9)11(14)8-13(2,3)12(15)16/h4-7H,8H2,1-3H3,(H,15,16)

SMILES: Cc1ccc(cc1)C(=O)CC(C)(C)C(=O)O

Synonyms:

• 2,2-Dimethyl-4-(4-methylphenyl)-4-oxobutanoic acid
• Benzenebutanoic Acid, Α,Α,4-Trimethyl-Γ-Oxo-

2,2-Dimethyl-4-(4-methylphenyl)-4-oxobutyric acid

CAS: 71821-98-2

Formula: C₁₃H₁₆O₃

Purity: 97.0%

Molecular weight: 220.268

Ref: 10-F207550