CymitQuimica logo

CAS 71824-24-3

:

2-(2-aminoethyl)-1H-isoindole-1,3(2H)-dione

Description:
2-(2-aminoethyl)-1H-isoindole-1,3(2H)-dione, also known by its CAS number 71824-24-3, is a chemical compound characterized by its isoindole structure, which features a bicyclic system comprising a five-membered ring fused to a six-membered ring. This compound contains an aminoethyl side chain, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amino group. The compound is of interest in medicinal chemistry and may possess properties that make it suitable for various applications, including as a potential pharmaceutical agent. Its reactivity can be influenced by the functional groups present, allowing for various chemical transformations. Additionally, the compound's stability and behavior under different conditions, such as pH and temperature, are important for its practical use in research and development. Overall, 2-(2-aminoethyl)-1H-isoindole-1,3(2H)-dione represents a unique structure with potential implications in drug discovery and development.
Formula:C10H10N2O2
InChI:InChI=1/C10H10N2O2/c11-5-6-12-9(13)7-3-1-2-4-8(7)10(12)14/h1-4H,5-6,11H2
SMILES:c1ccc2c(c1)C(=O)N(CCN)C2=O
Synonyms:
  • 1H-Isoindole-1,3(2H)-dione, 2-(2-aminoethyl)-
  • 2-(2-aminoethyl)-2,3-dihydro-1H-isoindole-1,3-dione
  • N-[2-Aminoethyl]phthalimide
  • 2-(2-Aminoethyl)-1H-isoindole-1,3(2H)-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.