CAS 71835-79-5
:L-α-Aspartyl-L-tryptophan
Description:
L-α-Aspartyl-L-tryptophan, also known by its CAS number 71835-79-5, is a dipeptide composed of the amino acids aspartic acid and tryptophan. This compound is characterized by its unique structure, which includes a peptide bond linking the carboxyl group of aspartic acid to the amino group of tryptophan. It is typically found in a crystalline form and is soluble in water, making it suitable for various biochemical applications. L-α-Aspartyl-L-tryptophan is of interest in the fields of nutrition and pharmacology due to its potential roles in neurotransmission and its influence on mood and cognitive functions. Additionally, it may exhibit antioxidant properties and has been studied for its effects on appetite regulation. The compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in its handling and application in research and industry. Overall, L-α-Aspartyl-L-tryptophan represents a significant area of study in peptide chemistry and its biological implications.
Formula:C15H17N3O5
InChI:InChI=1S/C15H17N3O5/c16-10(6-13(19)20)14(21)18-12(15(22)23)5-8-7-17-11-4-2-1-3-9(8)11/h1-4,7,10,12,17H,5-6,16H2,(H,18,21)(H,19,20)(H,22,23)/t10-,12-/m0/s1
InChI key:InChIKey=ZARXTZFGQZBYFO-JQWIXIFHSA-N
SMILES:C([C@H](NC([C@H](CC(O)=O)N)=O)C(O)=O)C=1C=2C(NC1)=CC=CC2
Synonyms:- L-Tryptophan, L-α-aspartyl-
- 22: PN: JP2009278928 PAGE: 12 claimed protein
- L-α-Aspartyl-L-tryptophan
- L-Aspartyl-L-tryptophan
- L-Tryptophan, N-L-α-aspartyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
H-Asp-Trp-OH
CAS:<p>Bachem ID: 4012139.</p>Formula:C15H17N3O5Purity:> 99%Color and Shape:Whitish PowderMolecular weight:319.32Antioxidant agent-9
CAS:Antioxidant agent-9, a peptide (Asp-Trp), shows antioxidant and similar SARS-CoV-2 antiviral strength to Chloroquine and Favipiravir.Formula:C15H17N3O5Color and Shape:SolidMolecular weight:319.31H-Asp-Trp-OH
CAS:<p>H-Asp-Trp-OH is a peptide that has been shown to have antioxidative activity and neuroprotective effects. It has also been shown to be a reactive compound that can interact with other molecules, such as thiobarbituric acid. H-Asp-Trp-OH has been shown to increase the number of neurons in the brain and may be helpful in reducing neuronal damage by apoptotic cell death. This peptide also has potential use in treating neurodegenerative diseases, such as Alzheimer's disease.</p>Formula:C15H17N3O5Purity:Min. 95%Molecular weight:319.31 g/mol


