CAS 7184-60-3
:Borrelidin
Description:
Borrelidin, with the CAS number 7184-60-3, is a naturally occurring compound that belongs to the class of polyketides. It is primarily derived from the bacterium *Borrelia burgdorferi*, which is known for causing Lyme disease. Borrelidin exhibits notable biological activity, particularly as an antibiotic, and has been studied for its potential therapeutic applications. The compound is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its reactivity and biological interactions. Borrelidin has shown promise in inhibiting certain enzymes and pathways in microbial organisms, making it a subject of interest in medicinal chemistry. Additionally, its unique structure and mechanism of action may provide insights into the development of new antimicrobial agents. However, further research is necessary to fully understand its pharmacological properties and potential side effects. Overall, Borrelidin represents a significant area of study within the field of natural products and antibiotic development.
Formula:C28H43NO6
InChI:InChI=1/C28H43NO6/c1-17-12-18(2)14-20(4)27(32)21(16-29)8-5-6-11-25(22-9-7-10-23(22)28(33)34)35-26(31)15-24(30)19(3)13-17/h5-6,8,17-20,22-25,27,30,32H,7,9-15H2,1-4H3,(H,33,34)/b6-5+,21-8-/t17-,18+,19-,20-,22+,23+,24-,25-,27+/m0/s1
InChI key:InChIKey=OJCKRNPLOZHAOU-UGKRXNSESA-N
SMILES:C(O)(=O)[C@H]1[C@@](CCC1)([C@]2(OC(=O)C[C@H](O)[C@@H](C)C[C@@H](C)C[C@@H](C)C[C@H](C)[C@@H](O)/C(/C#N)=C\C=C\C2)[H])[H]
Synonyms:- Oxacyclooctadecane, cyclopentanecarboxylic acid deriv.
- Cyclopentanecarboxylic acid, 2-(7-cyano-8,16-dihydroxy-9,11,13,15-tetramethyl-18-oxooxacyclooctadeca-4,6-dien-2-yl)-, [2S-[2R*(1S*,2S*),4E,6Z,8S*,9R*,11S*,13R*,15R*,16R*]]-
- Cyclopentanecarboxylic acid, 2-[(2S,4E,6Z,8R,9S,11R,13S,15S,16S)-7-cyano-8,16-dihydroxy-9,11,13,15-tetramethyl-18-oxooxacyclooctadeca-4,6-dien-2-yl]-, (1R,2R)-
- Borrelidin
- cyclopentanecarboxylic acid, 2-[(2S,4E,6Z,8R,9S,11R,13S,15S,16S)-7-cyano-8,16-dihydroxy-9,11,13,15-tetramethyl-18-oxooxacyclooctadeca-4,6-dien-2-yl]-, (1R,2R)-
- (1R,2R)-2-[(2S,4E,6Z,8R,9S,11R,13S,15S,16S)-7-Cyano-8,16-dihydroxy-9,11,13,15-tetramethyl-18-oxooxacyclooctadeca-4,6-dien-2-yl]cyclopentanecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Borrelidin
CAS:Borrelidin (Treponemycin) is an inhibitor of trehalose-6-phosphate synthase, a nitrogen-containing macrolide antibiotic isolated from Streptomyces rochei.Formula:C28H43NO6Purity:98%Color and Shape:White To Off-White PowderMolecular weight:489.64Borrelidin
CAS:BorrelidinFormula:C28H43NO6Purity:By hplc: 97.80% (Typical Value in Batch COA)Color and Shape: white powderMolecular weight:489.64g/molBorrelidin
CAS:Formula:C28H43NO6Purity:≥ 97.0%Color and Shape:White to off-white powderMolecular weight:489.64Borrelidin
CAS:Borrelidin is a potent antibiotic of the polyketide class, which is isolated from various Streptomyces species. Its mode of action is characterized by its inhibition of threonyl-tRNA synthetase, effectively disrupting protein synthesis within bacteria. Additionally, Borrelidin is known for its unique anti-angiogenic properties, which result from the inhibition of endothelial cell proliferation, making it a compound of interest in cancer research.
Purity:Min. 95%



