CymitQuimica logo

CAS 71843-98-6

:

(4R,7R,8R,9Z,14Z,16Z,20S)-20-hydroxy-4,8,16-trimethyl-7-(1-methylethyl)-6,23-dioxa-3,12,25-triazabicyclo[20.2.1]pentacosa-1(24),9,14,16,22(25)-pentaene-2,5,11-trione

Description:
The chemical substance with the name "(4R,7R,8R,9Z,14Z,16Z,20S)-20-hydroxy-4,8,16-trimethyl-7-(1-methylethyl)-6,23-dioxa-3,12,25-triazabicyclo[20.2.1]pentacosa-1(24),9,14,16,22(25)-pentaene-2,5,11-trione" and CAS number "71843-98-6" is a complex organic compound characterized by its unique bicyclic structure and multiple functional groups. It features a triazabicyclo framework, which contributes to its stability and reactivity. The presence of hydroxyl (-OH) and keto (C=O) groups indicates potential for hydrogen bonding and reactivity in various chemical environments. The compound's stereochemistry, denoted by the specific R and S configurations, suggests that it may exhibit chiral properties, influencing its biological activity and interactions. Additionally, the multiple double bonds (pentaene) within the structure may impart significant electronic properties, affecting its optical characteristics and reactivity. Overall, this compound's intricate structure and functional groups suggest potential applications in fields such as pharmaceuticals, materials science, or organic synthesis, although specific applications would depend on further research and characterization.
Formula:C26H37N3O6
InChI:InChI=1/C26H37N3O6/c1-16(2)24-18(4)11-12-22(31)27-13-7-9-17(3)8-6-10-20(30)14-23-29-21(15-34-23)25(32)28-19(5)26(33)35-24/h7-9,11-12,15-16,18-20,24,30H,6,10,13-14H2,1-5H3,(H,27,31)(H,28,32)/b9-7-,12-11-,17-8-/t18-,19-,20+,24-/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • A 17002 C

    CAS:
    <p>A 17002 C is a form of madumycin I. It is a metabolite produced by Actinoplanes strains, structurally related to the virginiamycin factor M.</p>
    Formula:C26H37N3O6
    Color and Shape:Solid
    Molecular weight:487.59