CymitQuimica logo

CAS 71847-92-2

:

2-oxo-1,2-dihydropyridin-3-yl cyclopropanecarboxylate

Description:
2-Oxo-1,2-dihydropyridin-3-yl cyclopropanecarboxylate, with the CAS number 71847-92-2, is a chemical compound that features a bicyclic structure incorporating a pyridine ring and a cyclopropane moiety. This compound is characterized by its unique combination of functional groups, including a ketone and an ester, which contribute to its reactivity and potential applications in organic synthesis. The presence of the dihydropyridine structure suggests that it may exhibit properties typical of heterocyclic compounds, such as biological activity or the ability to participate in various chemical reactions. Additionally, the cyclopropanecarboxylate group can influence the compound's steric and electronic properties, making it of interest in medicinal chemistry and material science. Its solubility, stability, and reactivity can vary depending on the specific conditions and solvents used. Overall, this compound represents a versatile building block for further chemical transformations and potential applications in drug development or as an intermediate in synthetic pathways.
Formula:C9H9NO3
InChI:InChI=1/C9H9NO3/c11-8-7(2-1-5-10-8)13-9(12)6-3-4-6/h1-2,5-6H,3-4H2,(H,10,11)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.