CAS 71848-87-8
:2,3-dihydroxypropyl [1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetate
Description:
2,3-Dihydroxypropyl [1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetate, with the CAS number 71848-87-8, is a synthetic organic compound characterized by its complex structure, which includes an indole moiety, a chlorobenzoyl group, and a dihydroxypropyl acetate functional group. This compound typically exhibits properties associated with indole derivatives, such as potential biological activity, including anti-inflammatory or anticancer effects, due to the presence of the indole ring, which is known for its role in various pharmacological activities. The chlorobenzoyl group may enhance lipophilicity, influencing the compound's solubility and permeability. Additionally, the hydroxyl groups contribute to its hydrophilicity and may participate in hydrogen bonding, affecting its reactivity and interaction with biological targets. Overall, this compound's unique combination of functional groups suggests potential applications in medicinal chemistry, although specific biological activities and mechanisms would require further investigation through experimental studies.
Formula:C22H22ClNO6
InChI:InChI=1/C22H22ClNO6/c1-13-18(10-21(27)30-12-16(26)11-25)19-9-17(29-2)7-8-20(19)24(13)22(28)14-3-5-15(23)6-4-14/h3-9,16,25-26H,10-12H2,1-2H3
SMILES:Cc1c(CC(=O)OCC(CO)O)c2cc(ccc2n1C(=O)c1ccc(cc1)Cl)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Indomethacin Impurity 9
CAS:Formula:C22H22ClNO6Color and Shape:Pale Yellow SolidMolecular weight:431.87Indomethancin (4-chlorobenzoyl-D4) glycerol ester
CAS:Controlled ProductFormula:C22D4H18ClNO6Color and Shape:NeatMolecular weight:435.891Indomethacin 1-Glycerin Ester
CAS:Applications Indometacin 1-Glycerin Ester was synthesized and evaluated for anti-flammatory activity in the rate paw carrageenin edema essay.
References Paris, Gerard. , et al.: J. Med. Chem, 23, 9 (1980)Formula:C22H22ClNO6Color and Shape:NeatMolecular weight:431.87


