CAS 71848-87-8

2,3-dihydroxypropyl [1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetate

Description:

2,3-Dihydroxypropyl [1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetate, with the CAS number 71848-87-8, is a synthetic organic compound characterized by its complex structure, which includes an indole moiety, a chlorobenzoyl group, and a dihydroxypropyl acetate functional group. This compound typically exhibits properties associated with indole derivatives, such as potential biological activity, including anti-inflammatory or anticancer effects, due to the presence of the indole ring, which is known for its role in various pharmacological activities. The chlorobenzoyl group may enhance lipophilicity, influencing the compound's solubility and permeability. Additionally, the hydroxyl groups contribute to its hydrophilicity and may participate in hydrogen bonding, affecting its reactivity and interaction with biological targets. Overall, this compound's unique combination of functional groups suggests potential applications in medicinal chemistry, although specific biological activities and mechanisms would require further investigation through experimental studies.

Formula: C₂₂H₂₂ClNO₆

InChI: InChI=1/C22H22ClNO6/c1-13-18(10-21(27)30-12-16(26)11-25)19-9-17(29-2)7-8-20(19)24(13)22(28)14-3-5-15(23)6-4-14/h3-9,16,25-26H,10-12H2,1-2H3

SMILES: Cc1c(CC(=O)OCC(CO)O)c2cc(ccc2n1C(=O)c1ccc(cc1)Cl)OC

Indomethacin Impurity 9

CAS: 71848-87-8

Formula: C₂₂H₂₂ClNO₆

Color and Shape: Pale Yellow Solid

Molecular weight: 431.87

Ref: 4Z-I-1223

Indomethancin (4-chlorobenzoyl-D4) glycerol ester

Controlled Product

CAS: 71848-87-8

Formula: C₂₂D₄H₁₈ClNO₆

Color and Shape: Neat

Molecular weight: 435.891

Ref: TR-E718484

Indomethacin 1-Glycerin Ester

CAS: 71848-87-8

Applications Indometacin 1-Glycerin Ester was synthesized and evaluated for anti-flammatory activity in the rate paw carrageenin edema essay.
References Paris, Gerard. , et al.: J. Med. Chem, 23, 9 (1980)

Formula: C₂₂H₂₂ClNO₆

Color and Shape: Neat

Molecular weight: 431.87

Ref: TR-E718480

Indomethacin-α-Monoglyceride

CAS: 71848-87-8

Formula: C₂₂H₂₂ClNO₆

Molecular weight: 431.87

Ref: ST-EA-CP-I7019