
CAS 71857-06-2
:α,2-Dihydroxy-3-methoxybenzeneacetic acid
Description:
α,2-Dihydroxy-3-methoxybenzeneacetic acid, also known by its CAS number 71857-06-2, is an organic compound characterized by its aromatic structure featuring a methoxy group and two hydroxyl groups. This compound belongs to the class of phenolic acids and is derived from the phenolic structure of benzene. Its molecular structure includes a benzene ring substituted with a methoxy group (-OCH₃) and two hydroxyl groups (-OH) at the 2 and α positions, along with an acetic acid moiety. The presence of these functional groups contributes to its potential biological activity, including antioxidant properties. The compound is typically soluble in polar solvents due to its hydroxyl groups, which can engage in hydrogen bonding. Its applications may extend to pharmaceuticals, where it could serve as an intermediate or active ingredient, and in research settings for studying its biochemical interactions. Overall, α,2-Dihydroxy-3-methoxybenzeneacetic acid is notable for its structural features and potential utility in various chemical and biological contexts.
Formula:C9H10O5
InChI:InChI=1S/C9H10O5/c1-14-6-4-2-3-5(7(6)10)8(11)9(12)13/h2-4,8,10-11H,1H3,(H,12,13)
InChI key:InChIKey=SYMPFBURZFGXAS-UHFFFAOYSA-N
SMILES:C(C(O)=O)(O)C1=C(O)C(OC)=CC=C1
Synonyms:- 2-Hydroxy-3-methoxymandelic acid
- α,2-Dihydroxy-3-methoxybenzeneacetic acid
- 2-Hydroxy-2-(2-hydroxy-3-methoxyphenyl)acetic acid
- dl-α,2-Dihydroxy-3-methoxybenzeneacetic acid
- Benzeneacetic acid, α,2-dihydroxy-3-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.