CAS 71859-81-9
:2-chloro-5-ethyl-1,3,4-thiadiazole
Description:
2-Chloro-5-ethyl-1,3,4-thiadiazole is a heterocyclic compound characterized by the presence of a thiadiazole ring, which consists of two nitrogen atoms and one sulfur atom in a five-membered ring structure. The compound features a chlorine atom at the second position and an ethyl group at the fifth position of the thiadiazole ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow solid and is soluble in organic solvents. This compound is of interest in various fields, including agrochemicals and pharmaceuticals, due to its potential biological activity. Its structure allows for various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the presence of the chlorine and ethyl substituents can influence its reactivity and interaction with biological systems. Safety data should be consulted for handling, as with many halogenated compounds, it may pose health risks if not managed properly.
Formula:C4H5ClN2S
InChI:InChI=1/C4H5ClN2S/c1-2-3-6-7-4(5)8-3/h2H2,1H3
SMILES:CCc1nnc(Cl)s1
Synonyms:- 2-Ethyl-5-chloro-1,3,4-thiadiazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Chloro-5-ethyl-1,3,4-thiadiazole
CAS:2-Chloro-5-ethyl-1,3,4-thiadiazole is a volatile organic compound that can be found in the headspace of crops and soils. It is also a metabolite produced by various fungi and bacteria. 2-Chloro-5-ethyl-1,3,4-thiadiazole has been shown to inhibit the growth of Erysiphe cichoracearum and Fusarium oxysporum f. sp. lycopersici. It has also been shown to have antiinflammatory properties in mice due to its ability to suppress the production of prostaglandins.Formula:C4H5ClN2SPurity:Min. 95%Color and Shape:Yellow PowderMolecular weight:148.61 g/mol2-chloro-5-ethyl-1,3,4-thiadiazole
CAS:Formula:C4H5ClN2SPurity:95.0%Color and Shape:LiquidMolecular weight:148.61

