CAS 718602-89-2

3-[(4-fluorobenzyl)amino]benzoic acid

Description:

3-[(4-Fluorobenzyl)amino]benzoic acid, with the CAS number 718602-89-2, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety and a 4-fluorobenzyl amino group. This compound features a carboxylic acid functional group (-COOH) that contributes to its acidity and potential for hydrogen bonding. The presence of the fluorine atom on the benzyl group can influence the compound's electronic properties, potentially enhancing its lipophilicity and altering its reactivity. The amino group (-NH2) allows for further interactions, such as forming salts or participating in amide bond formation. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility characteristics are likely influenced by the balance between the hydrophilic carboxylic acid and the hydrophobic aromatic rings. Overall, 3-[(4-fluorobenzyl)amino]benzoic acid is a versatile compound with potential applications in medicinal chemistry and material science.

Formula: C₁₄H₁₂FNO₂

InChI: InChI=1/C14H12FNO2/c15-12-6-4-10(5-7-12)9-16-13-3-1-2-11(8-13)14(17)18/h1-8,16H,9H2,(H,17,18)

SMILES: c1cc(cc(c1)NCc1ccc(cc1)F)C(=O)O

Synonyms:

• Benzoic Acid, 3-[[(4-Fluorophenyl)Methyl]Amino]-