CAS 718613-20-8

2,2,3,3,4,4,5,5,6,6-decadeuterio-1-(4-piperidyl)piperidine

Description:

2,2,3,3,4,4,5,5,6,6-decadeuterio-1-(4-piperidyl)piperidine is a deuterated derivative of piperidine, a cyclic amine commonly used in organic synthesis and pharmaceutical applications. The presence of ten deuterium atoms indicates that this compound is isotopically labeled, which can be useful in studies involving metabolic pathways, drug metabolism, and pharmacokinetics. The piperidyl group suggests potential interactions with biological systems, as piperidine derivatives often exhibit significant biological activity, including analgesic and anti-anxiety effects. The compound's structure likely contributes to its lipophilicity, influencing its ability to cross biological membranes. Additionally, the deuteration can enhance the stability of the compound and alter its reactivity compared to its non-deuterated counterparts. Overall, this substance is of interest in both research and potential therapeutic applications, particularly in the context of studying drug behavior and interactions in biological systems.

Formula: C₁₀H₁₀D₁₀N₂

InChI: InChI=1/C10H20N2/c1-2-8-12(9-3-1)10-4-6-11-7-5-10/h10-11H,1-9H2/i1D2,2D2,3D2,8D2,9D2

SMILES: C1(C(C(N(C(C1([2H])[2H])([2H])[2H])C1CCNCC1)([2H])[2H])([2H])[2H])([2H])[2H]

1,4'-Bipiperidine-2,2,3,3,4,4,5,5,6,6-d10

Controlled Product

CAS: 718613-20-8

Formula: C₁₀H₁₀D₁₀N₂

Color and Shape: Neat

Molecular weight: 178.34

Ref: TR-B398962