
CAS 718613-22-0
:[1,4′-Bipiperidine-2,2,3,3,4,4,5,5,6,6-d10]-1′-carbonyl chloride, monohydrochloride
Description:
[1,4′-Bipiperidine-2,2,3,3,4,4,5,5,6,6-d10]-1′-carbonyl chloride, monohydrochloride, with CAS number 718613-22-0, is a deuterated organic compound that features a bipiperidine structure, which consists of two piperidine rings connected by a carbon chain. The presence of deuterium isotopes (d10) indicates that the hydrogen atoms in specific positions have been replaced with deuterium, enhancing its utility in various analytical techniques, such as NMR spectroscopy. The carbonyl chloride functional group suggests that this compound can participate in nucleophilic acyl substitution reactions, making it a potential intermediate in organic synthesis. The monohydrochloride designation indicates that the compound exists as a hydrochloride salt, which can influence its solubility and stability in different solvents. Overall, this compound is of interest in medicinal chemistry and materials science, particularly for its potential applications in drug development and as a building block in complex organic synthesis.
Formula:C11H9ClD10N2O·ClH
InChI:InChI=1S/C11H19ClN2O.ClH/c12-11(15)14-8-4-10(5-9-14)13-6-2-1-3-7-13;/h10H,1-9H2;1H/i1D2,2D2,3D2,6D2,7D2;
InChI key:InChIKey=VBXXNCHZAMNCBX-DEIQIEEISA-N
SMILES:C(Cl)(=O)N1CCC(CC1)N2C(C(C(C(C2([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H].Cl
Synonyms:- [1,4′-Bipiperidine]-1′-carbonyl-d10 Chloride Hydrochloride
- [1,4′-Bipiperidine-2,2,3,3,4,4,5,5,6,6-d10]-1′-carbonyl chloride, monohydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
[1,4'-Bipiperidine]-1'-carbonyl-d10 Chloride Hydrochloride
CAS:Controlled Product<p>Applications Reactant used in the preparation of labelled Camptothecin derivatives.<br></p>Formula:C11H10D10Cl2N2OColor and Shape:NeatMolecular weight:277.26
