CAS 71862-02-7

N-(3-chloro-2-methylphenyl)formamide

Description:

N-(3-chloro-2-methylphenyl)formamide is an organic compound characterized by its amide functional group, which is derived from formic acid and an aromatic amine. This compound features a chloro-substituted aromatic ring, specifically a 3-chloro-2-methylphenyl group, which contributes to its chemical properties and reactivity. The presence of the chlorine atom introduces electronegativity, potentially influencing the compound's polarity and solubility in various solvents. As an amide, it may exhibit hydrogen bonding capabilities, affecting its boiling and melting points. The compound is likely to be stable under standard conditions but may undergo hydrolysis or other reactions under specific circumstances, such as in the presence of strong acids or bases. Its applications could span various fields, including pharmaceuticals and agrochemicals, where it may serve as an intermediate in the synthesis of more complex molecules. Safety data should be consulted to understand its toxicity and handling requirements, as with any chemical substance.

Formula: C₈H₈ClNO

InChI: InChI=1/C8H8ClNO/c1-6-7(9)3-2-4-8(6)10-5-11/h2-5H,1H3,(H,10,11)

SMILES: Cc1c(cccc1N=CO)Cl

Synonyms:

• formamide, N-(3-chloro-2-methylphenyl)-
• N-(3-Chloro-2-methylphenyl)formamide

N-(3-Chloro-2-methylphenyl)formamide

CAS: 71862-02-7

N-(3-Chloro-2-methylphenyl)formamide

Purity: 95%

Molecular weight: 169.61g/mol

Ref: 54-OR914491

3′-Chloro-o-formotoluidide

CAS: 71862-02-7

Formula: C₈H₈ClNO

Purity: 97.0%

Molecular weight: 169.61

Ref: 10-F403366