CAS 718628-26-3
:iodo-(2,4,6-trimethylphenyl)zinc
Description:
Iodo-(2,4,6-trimethylphenyl)zinc, with the CAS number 718628-26-3, is an organozinc compound characterized by the presence of a zinc atom bonded to an iodo-substituted aromatic ring, specifically 2,4,6-trimethylphenyl. This compound typically exhibits a white to light yellow solid appearance and is sensitive to moisture and air, necessitating careful handling under inert atmospheres. It is known for its reactivity in organic synthesis, particularly in cross-coupling reactions, where it can serve as a nucleophile in the formation of carbon-carbon bonds. The presence of the iodo group enhances its reactivity, making it a valuable intermediate in the synthesis of various organic compounds. Additionally, the trimethyl groups on the phenyl ring can influence the electronic properties and steric hindrance, affecting the compound's reactivity and selectivity in chemical reactions. As with many organometallic compounds, safety precautions are essential due to potential toxicity and reactivity with water or air.
Formula:C9H11IZn
InChI:InChI=1/C9H11.HI.Zn/c1-7-4-8(2)6-9(3)5-7;;/h4-5H,1-3H3;1H;/q;;+1/p-1/rC9H11IZn/c1-6-4-7(2)9(11-10)8(3)5-6/h4-5H,1-3H3
SMILES:Cc1cc(C)cc(C)c1.I.[Zn]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.