CAS 7187-47-5

4-(1H-benzimidazol-2-yl)-1,3-thiazol-2-amine

Description:

4-(1H-benzimidazol-2-yl)-1,3-thiazol-2-amine, with the CAS number 7187-47-5, is a heterocyclic compound characterized by the presence of both benzimidazole and thiazole moieties. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. It is often studied for its potential as an antimicrobial or anticancer agent due to its ability to interact with biological targets. The structure features a thiazole ring, which contributes to its chemical reactivity and potential for forming coordination complexes with metal ions. Additionally, the presence of the amine group enhances its solubility in polar solvents and may influence its pharmacokinetic properties. The compound is generally stable under standard laboratory conditions but may require specific handling precautions due to its biological activity. Overall, 4-(1H-benzimidazol-2-yl)-1,3-thiazol-2-amine represents a significant class of compounds in the field of pharmaceutical research, with ongoing studies aimed at elucidating its mechanisms of action and therapeutic potential.

Formula: C₁₀H₈N₄S

InChI: InChI=1/C10H8N4S/c11-10-14-8(5-15-10)9-12-6-3-1-2-4-7(6)13-9/h1-5H,(H2,11,14)(H,12,13)

SMILES: c1ccc2c(c1)nc(c1csc(=N)[nH]1)[nH]2

Synonyms:

• 2-thiazolamine, 4-(1H-benzimidazol-2-yl)-