CAS 7187-84-0
:2,4,6-Triphenoxyboroxin
Description:
2,4,6-Triphenoxyboroxin, with the CAS number 7187-84-0, is a boron-containing organic compound characterized by its unique structure, which features a boron atom bonded to three phenoxy groups. This compound is part of a class of boron compounds known for their potential applications in materials science and organic synthesis. It typically exhibits a white to light yellow crystalline appearance and is soluble in organic solvents. The presence of phenoxy groups contributes to its stability and reactivity, making it useful in various chemical reactions, including those involving coordination chemistry. Additionally, 2,4,6-Triphenoxyboroxin may exhibit interesting optical and electronic properties due to its aromatic nature. Safety data indicates that, like many boron compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, its unique structural characteristics and potential applications make it a compound of interest in both academic and industrial research settings.
Formula:C18H15B3O6
InChI:InChI=1S/C18H15B3O6/c1-4-10-16(11-5-1)22-19-25-20(23-17-12-6-2-7-13-17)27-21(26-19)24-18-14-8-3-9-15-18/h1-15H
InChI key:InChIKey=ZPVJTIGAPMDEQX-UHFFFAOYSA-N
SMILES:O(B1OB(OC2=CC=CC=C2)OB(OC3=CC=CC=C3)O1)C4=CC=CC=C4
Synonyms:- Boroxin, triphenoxy-
- Triphenoxyboroxin
- 2,4,6-Triphenoxy-1,3,5,2,4,6-trioxatriborinane
- 2,4,6-Triphenoxyboroxin
- Boroxin, 2,4,6-triphenoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
