CymitQuimica logo

CAS 71887-28-0

:

Methyl 2-bromomethyl-3-methoxybenzoate

Description:
Methyl 2-bromomethyl-3-methoxybenzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. It features a methoxy group (-OCH3) and a bromomethyl group (-CH2Br) attached to the aromatic ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the bromine atom makes it a suitable candidate for nucleophilic substitution reactions, while the methoxy group can influence the compound's electronic properties and solubility. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is important to handle it with care due to the presence of bromine, which can be hazardous. Methyl 2-bromomethyl-3-methoxybenzoate may be utilized in various chemical reactions, including the synthesis of more complex organic molecules, and can serve as an intermediate in pharmaceutical or agrochemical development. Proper storage and handling protocols should be followed to ensure safety and stability.
Formula:C10H11BrO3
InChI:InChI=1/C10H11BrO3/c1-13-9-5-3-4-7(8(9)6-11)10(12)14-2/h3-5H,6H2,1-2H3
InChI key:HYLGKOGJOVGRNN-UHFFFAOYSA-N
SMILES:COc1cccc(c1CBr)C(=O)OC
Synonyms:
  • 2-Bromomethyl-3-methoxybenzoic acid methyl ester
  • Methyl 2-(bromomethyl)-3-methoxybenzoate
Found 5 products.